C26H28N4O12S2 — CID 171460419
2-amino-3-[[2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]propanoic acid (PubChem CID 171460419) has the molecular formula C26H28N4O12S2 and a molecular weight of 652.66 g/mol. Its IUPAC name is 2-amino-3-[[2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 2-amino-3-[[2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171460419 |
| Molecular Formula | C26H28N4O12S2 |
| Molecular Weight | 652.66 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | 2-amino-3-[[2-[7-[bis(3-sulfopropyl)amino]-2-oxochromen-3-yl]-1,3-benzoxazole-5-carbonyl]amino]propanoic acid |
| SMILES | NC(CNC(=O)c1ccc2oc(-c3cc4ccc(N(CCCS(=O)(=O)O)CCCS(=O)(=O)O)cc4oc3=O)nc2c1)C(=O)O |
| InChI | InChI=1S/C26H28N4O12S2/c27-19(25(32)33)14-28-23(31)16-4-6-21-20(12-16)29-24(41-21)18-11-15-3-5-17(13-22(15)42-26(18)34)30(7-1-9-43(35,36)37)8-2-10-44(38,39)40/h3-6,11-13,19H,1-2,7-10,14,27H2,(H,28,31)(H,32,33)(H,35,36,37)(H,38,39,40) |
| InChIKey | SMCVZZNBGMBTPO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 260.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|