About 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid
4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid (PubChem CID 171460430) has the molecular formula C33H28N2O4
and a molecular weight of 516.60 g/mol. Its IUPAC name is 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid |
| PubChem CID | 171460430 |
| Molecular Formula | C33H28N2O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid |
| SMILES | CCNC(=O)c1cc(C(=O)NCC)cc(-c2c3ccccc3c(-c3ccc(C(=O)O)cc3)c3ccccc23)c1 |
| InChI | InChI=1S/C33H28N2O4/c1-3-34-31(36)23-17-22(18-24(19-23)32(37)35-4-2)30-27-11-7-5-9-25(27)29(26-10-6-8-12-28(26)30)20-13-15-21(16-14-20)33(38)39/h5-19H,3-4H2,1-2H3,(H,34,36)(H,35,37)(H,38,39) |
| InChIKey | GDCCCHFMXHXZJO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid?
The IUPAC name of 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid (CID 171460430) is 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid.
What is the SMILES notation for 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid?
The canonical SMILES for 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid is CCNC(=O)c1cc(C(=O)NCC)cc(-c2c3ccccc3c(-c3ccc(C(=O)O)cc3)c3ccccc23)c1.
What is the InChIKey of 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid?
The InChIKey is GDCCCHFMXHXZJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H28N2O4/c1-3-34-31(36)23-17-22(18-24(19-23)32(37)35-4-2)30-27-11-7-5-9-25(27)29(26-10-6-8-12-28(26)30)20-13-15-21(16-14-20)33(38)39/h5-19H,3-4H2,1-2H3,(H,34,36)(H,35,37)(H,38,39).
What are the key properties of 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid?
4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid has a molecular weight of 516.60 g/mol, XLogP of 6.52, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[10-[3,5-bis(ethylcarbamoyl)phenyl]anthracen-9-yl]benzoic acid is sourced from PubChem (CID 171460430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).