C58H43N — CID 171461488
1,3,4,5,6,7,8-heptadeuterio-N-[2-(9,9-diphenylfluoren-4-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 171461488) has the molecular formula C58H43N and a molecular weight of 761.03 g/mol. Its IUPAC name is 1,3,4,5,6,7,8-heptadeuterio-N-[2-(9,9-diphenylfluoren-4-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 1,3,4,5,6,7,8-heptadeuterio-N-[2-(9,9-diphenylfluoren-4-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 171461488 |
| Molecular Formula | C58H43N |
| Molecular Weight | 761.03 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 1,3,4,5,6,7,8-heptadeuterio-N-[2-(9,9-diphenylfluoren-4-yl)phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3cccc4c3-c3ccccc3C4(c3ccccc3)c3ccccc3)c([2H])c1C2(C)C |
| InChI | InChI=1S/C58H43N/c1-57(2)51-29-15-12-25-46(51)47-38-37-45(39-54(47)57)59(44-35-33-41(34-36-44)40-19-6-3-7-20-40)55-32-17-14-26-48(55)49-28-18-31-53-56(49)50-27-13-16-30-52(50)58(53,42-21-8-4-9-22-42)43-23-10-5-11-24-43/h3-39H,1-2H3/i12D,15D,25D,29D,37D,38D,39D |
| InChIKey | YPAYPCILAPMEJG-LGSXNQATSA-N |
| XLogP | 15.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.03 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |