C22H28F2N4O2Si — CID 171465734
3-[[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]oxymethyl]-2,4-difluoroaniline (PubChem CID 171465734) has the molecular formula C22H28F2N4O2Si and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]oxymethyl]-2,4-difluoroaniline.
| Compound Name | 3-[[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]oxymethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 171465734 |
| Molecular Formula | C22H28F2N4O2Si |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-[[3-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-b]pyridin-5-yl]oxymethyl]-2,4-difluoroaniline |
| SMILES | C[Si](C)(C)CCOCn1nc(C2CC2)c2cc(OCc3c(F)ccc(N)c3F)cnc21 |
| InChI | InChI=1S/C22H28F2N4O2Si/c1-31(2,3)9-8-29-13-28-22-16(21(27-28)14-4-5-14)10-15(11-26-22)30-12-17-18(23)6-7-19(25)20(17)24/h6-7,10-11,14H,4-5,8-9,12-13,25H2,1-3H3 |
| InChIKey | WSBPHUIIDNSEKN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|