C18H26BN3O4 — CID 171465789
4-methoxy-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine (PubChem CID 171465789) has the molecular formula C18H26BN3O4 and a molecular weight of 359.24 g/mol. Its IUPAC name is 4-methoxy-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine.
| Compound Name | 4-methoxy-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 171465789 |
| Molecular Formula | C18H26BN3O4 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-methoxy-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine |
| SMILES | COc1c(B2OC(C)(C)C(C)(C)O2)cnc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C18H26BN3O4/c1-17(2)18(3,4)26-19(25-17)13-11-20-16-12(15(13)23-5)10-21-22(16)14-8-6-7-9-24-14/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | PFRHJQYJFGAJMD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|