C26H52NO6+ — CID 171467662
bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-bis(3-propan-2-yloxypropyl)azanium (PubChem CID 171467662) has the molecular formula C26H52NO6+ and a molecular weight of 474.70 g/mol. Its IUPAC name is bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-bis(3-propan-2-yloxypropyl)azanium.
| Compound Name | bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-bis(3-propan-2-yloxypropyl)azanium |
|---|---|
| PubChem CID | 171467662 |
| Molecular Formula | C26H52NO6+ |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.38 |
| IUPAC Name | bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-bis(3-propan-2-yloxypropyl)azanium |
| SMILES | CC(C)OCCC[N+](CCCOC(C)C)(CCC(=O)OC(C)(C)C)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H52NO6/c1-21(2)30-19-11-15-27(16-12-20-31-22(3)4,17-13-23(28)32-25(5,6)7)18-14-24(29)33-26(8,9)10/h21-22H,11-20H2,1-10H3/q+1 |
| InChIKey | KDPOGEXKLBCJPZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|