About [(2R)-4,4-difluorooxolan-2-yl]methanamine
[(2R)-4,4-difluorooxolan-2-yl]methanamine (PubChem CID 171468237) has the molecular formula C5H9F2NO
and a molecular weight of 137.13 g/mol. Its IUPAC name is [(2R)-4,4-difluorooxolan-2-yl]methanamine.
Molecular Properties
| Compound Name | [(2R)-4,4-difluorooxolan-2-yl]methanamine |
| PubChem CID | 171468237 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | [(2R)-4,4-difluorooxolan-2-yl]methanamine |
| SMILES | NC[C@H]1CC(F)(F)CO1 |
| InChI | InChI=1S/C5H9F2NO/c6-5(7)1-4(2-8)9-3-5/h4H,1-3,8H2/t4-/m1/s1 |
| InChIKey | RCJPAVRVGWPQNL-SCSAIBSYSA-N |
| XLogP | 0.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-4,4-difluorooxolan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4,4-difluorooxolan-2-yl]methanamine?
The IUPAC name of [(2R)-4,4-difluorooxolan-2-yl]methanamine (CID 171468237) is [(2R)-4,4-difluorooxolan-2-yl]methanamine.
What is the SMILES notation for [(2R)-4,4-difluorooxolan-2-yl]methanamine?
The canonical SMILES for [(2R)-4,4-difluorooxolan-2-yl]methanamine is NC[C@H]1CC(F)(F)CO1.
What is the InChIKey of [(2R)-4,4-difluorooxolan-2-yl]methanamine?
The InChIKey is RCJPAVRVGWPQNL-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H9F2NO/c6-5(7)1-4(2-8)9-3-5/h4H,1-3,8H2/t4-/m1/s1.
What are the key properties of [(2R)-4,4-difluorooxolan-2-yl]methanamine?
[(2R)-4,4-difluorooxolan-2-yl]methanamine has a molecular weight of 137.13 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4,4-difluorooxolan-2-yl]methanamine is sourced from PubChem (CID 171468237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).