C33H20Y2-2 — CID 171469451
12,12-di(phenyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene;bis(yttrium) (PubChem CID 171469451) has the molecular formula C33H20Y2-2 and a molecular weight of 594.34 g/mol. Its IUPAC name is 12,12-di(phenyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene;bis(yttrium).
| Compound Name | 12,12-di(phenyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene;bis(yttrium) |
|---|---|
| PubChem CID | 171469451 |
| Molecular Formula | C33H20Y2-2 |
| Molecular Weight | 594.34 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | 12,12-di(phenyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene;bis(yttrium) |
| SMILES | [Y].[Y].[c-]1ccc(C2(c3cc[c-]cc3)c3cc4ccccc4cc3-c3cc4ccccc4cc32)cc1 |
| InChI | InChI=1S/C33H20.2Y/c1-3-15-27(16-4-1)33(28-17-5-2-6-18-28)31-21-25-13-9-7-11-23(25)19-29(31)30-20-24-12-8-10-14-26(24)22-32(30)33;;/h3-22H;;/q-2;; |
| InChIKey | QCUHKBMFCJULCE-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.34 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|