C15H14F2N2O3 — CID 171470028
N-[3-(difluoromethoxy)cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 171470028) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 171470028 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-[3-(difluoromethoxy)cyclobutyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CC(OC(F)F)C1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H14F2N2O3/c16-15(17)21-11-6-10(7-11)18-14(20)12-8-13(22-19-12)9-4-2-1-3-5-9/h1-5,8,10-11,15H,6-7H2,(H,18,20) |
| InChIKey | CZWQJZPMGPLFEA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |