C19H13N3O5 — CID 171470650
4-(4-methoxyanilino)-2,3-dioxo-1H-pyrrolo[3,2-c]quinoline-7-carboxylic acid (PubChem CID 171470650) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-2,3-dioxo-1H-pyrrolo[3,2-c]quinoline-7-carboxylic acid.
| Compound Name | 4-(4-methoxyanilino)-2,3-dioxo-1H-pyrrolo[3,2-c]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 171470650 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-(4-methoxyanilino)-2,3-dioxo-1H-pyrrolo[3,2-c]quinoline-7-carboxylic acid |
| SMILES | COc1ccc(Nc2nc3cc(C(=O)O)ccc3c3c2C(=O)C(=O)N3)cc1 |
| InChI | InChI=1S/C19H13N3O5/c1-27-11-5-3-10(4-6-11)20-17-14-15(22-18(24)16(14)23)12-7-2-9(19(25)26)8-13(12)21-17/h2-8H,1H3,(H,20,21)(H,25,26)(H,22,23,24) |
| InChIKey | DXGXOCBFZZNFIL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|