C25H24BrF2N5O4S — CID 171470689
(3R)-N-[3-[3-(4-bromocyclohexyl)-4-oxoquinazolin-6-yl]oxy-2-cyano-4-fluorophenyl]-3-fluoropyrrolidine-1-sulfonamide (PubChem CID 171470689) has the molecular formula C25H24BrF2N5O4S and a molecular weight of 608.47 g/mol. Its IUPAC name is (3R)-N-[3-[3-(4-bromocyclohexyl)-4-oxoquinazolin-6-yl]oxy-2-cyano-4-fluorophenyl]-3-fluoropyrrolidine-1-sulfonamide.
| Compound Name | (3R)-N-[3-[3-(4-bromocyclohexyl)-4-oxoquinazolin-6-yl]oxy-2-cyano-4-fluorophenyl]-3-fluoropyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 171470689 |
| Molecular Formula | C25H24BrF2N5O4S |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 607.07 |
| IUPAC Name | (3R)-N-[3-[3-(4-bromocyclohexyl)-4-oxoquinazolin-6-yl]oxy-2-cyano-4-fluorophenyl]-3-fluoropyrrolidine-1-sulfonamide |
| SMILES | N#Cc1c(NS(=O)(=O)N2CC[C@@H](F)C2)ccc(F)c1Oc1ccc2ncn(C3CCC(Br)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C25H24BrF2N5O4S/c26-15-1-3-17(4-2-15)33-14-30-22-7-5-18(11-19(22)25(33)34)37-24-20(12-29)23(8-6-21(24)28)31-38(35,36)32-10-9-16(27)13-32/h5-8,11,14-17,31H,1-4,9-10,13H2/t15?,16-,17?/m1/s1 |
| InChIKey | ZGQSHXLRHSFSKS-AQFXKWCLSA-N |
| XLogP | 4.78 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|