C10H9F4NO2 — CID 171471199
N-[(1R)-2,2,2-trifluoro-1-(5-fluoro-2-hydroxyphenyl)ethyl]acetamide (PubChem CID 171471199) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trifluoro-1-(5-fluoro-2-hydroxyphenyl)ethyl]acetamide.
| Compound Name | N-[(1R)-2,2,2-trifluoro-1-(5-fluoro-2-hydroxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 171471199 |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-[(1R)-2,2,2-trifluoro-1-(5-fluoro-2-hydroxyphenyl)ethyl]acetamide |
| SMILES | CC(=O)N[C@H](c1cc(F)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C10H9F4NO2/c1-5(16)15-9(10(12,13)14)7-4-6(11)2-3-8(7)17/h2-4,9,17H,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | PUJMMLMPQMELRC-SECBINFHSA-N |
| XLogP | 2.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|