C12H15N5O2 — CID 171471349
N-methyl-9-oxo-1,6,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide (PubChem CID 171471349) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-methyl-9-oxo-1,6,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | N-methyl-9-oxo-1,6,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 171471349 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-methyl-9-oxo-1,6,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(n1)NC(=O)C1CNCCN21 |
| InChI | InChI=1S/C12H15N5O2/c1-13-11(18)7-2-3-8-10(15-7)16-12(19)9-6-14-4-5-17(8)9/h2-3,9,14H,4-6H2,1H3,(H,13,18)(H,15,16,19) |
| InChIKey | JPFBOPRKRISUDN-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |