About 6-benzyl-3-phenylfuro[3,2-b]pyridine
6-benzyl-3-phenylfuro[3,2-b]pyridine (PubChem CID 171471568) has the molecular formula C20H15NO
and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-benzyl-3-phenylfuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-benzyl-3-phenylfuro[3,2-b]pyridine |
| PubChem CID | 171471568 |
| Molecular Formula | C20H15NO |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 6-benzyl-3-phenylfuro[3,2-b]pyridine |
| SMILES | c1ccc(Cc2cnc3c(-c4ccccc4)coc3c2)cc1 |
| InChI | InChI=1S/C20H15NO/c1-3-7-15(8-4-1)11-16-12-19-20(21-13-16)18(14-22-19)17-9-5-2-6-10-17/h1-10,12-14H,11H2 |
| InChIKey | MBJFGPSKIVHHRE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-benzyl-3-phenylfuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3-phenylfuro[3,2-b]pyridine?
The IUPAC name of 6-benzyl-3-phenylfuro[3,2-b]pyridine (CID 171471568) is 6-benzyl-3-phenylfuro[3,2-b]pyridine.
What is the SMILES notation for 6-benzyl-3-phenylfuro[3,2-b]pyridine?
The canonical SMILES for 6-benzyl-3-phenylfuro[3,2-b]pyridine is c1ccc(Cc2cnc3c(-c4ccccc4)coc3c2)cc1.
What is the InChIKey of 6-benzyl-3-phenylfuro[3,2-b]pyridine?
The InChIKey is MBJFGPSKIVHHRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO/c1-3-7-15(8-4-1)11-16-12-19-20(21-13-16)18(14-22-19)17-9-5-2-6-10-17/h1-10,12-14H,11H2.
What are the key properties of 6-benzyl-3-phenylfuro[3,2-b]pyridine?
6-benzyl-3-phenylfuro[3,2-b]pyridine has a molecular weight of 285.35 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3-phenylfuro[3,2-b]pyridine is sourced from PubChem (CID 171471568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).