C28H25ClFN7O5 — CID 171471746
[(2S,3R,4R)-4-acetyloxy-3-azido-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 171471746) has the molecular formula C28H25ClFN7O5 and a molecular weight of 594.00 g/mol. Its IUPAC name is [(2S,3R,4R)-4-acetyloxy-3-azido-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R)-4-acetyloxy-3-azido-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 171471746 |
| Molecular Formula | C28H25ClFN7O5 |
| Molecular Weight | 594.00 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | [(2S,3R,4R)-4-acetyloxy-3-azido-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1C(n2ncc3c(N[C@@H](C)c4ccccc4F)cc(Cl)nc32)O[C@H](COC(=O)c2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H25ClFN7O5/c1-15(18-10-6-7-11-20(18)30)33-21-12-23(29)34-26-19(21)13-32-37(26)27-25(41-16(2)38)24(35-36-31)22(42-27)14-40-28(39)17-8-4-3-5-9-17/h3-13,15,22,24-25,27H,14H2,1-2H3,(H,33,34)/t15-,22+,24+,25+,27?/m0/s1 |
| InChIKey | RFBMXPMHGZVABQ-OHZZZZIOSA-N |
| XLogP | 5.76 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|