C25H32F2O5Si — CID 171471766
(3aR,5R,6R,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(difluoromethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 171471766) has the molecular formula C25H32F2O5Si and a molecular weight of 478.61 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(difluoromethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(difluoromethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 171471766 |
| Molecular Formula | C25H32F2O5Si |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(difluoromethyl)-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@](O)(C(F)F)[C@H]2O1 |
| InChI | InChI=1S/C25H32F2O5Si/c1-23(2,3)33(17-12-8-6-9-13-17,18-14-10-7-11-15-18)29-16-19-25(28,22(26)27)20-21(30-19)32-24(4,5)31-20/h6-15,19-22,28H,16H2,1-5H3/t19-,20+,21-,25-/m1/s1 |
| InChIKey | VAKIQIWQHXOQBX-FBROZUCGSA-N |
| XLogP | 3.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|