C10H16Br2N2O3 — CID 171472470
3,4-dibromo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrazole (PubChem CID 171472470) has the molecular formula C10H16Br2N2O3 and a molecular weight of 372.06 g/mol. Its IUPAC name is 3,4-dibromo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrazole.
| Compound Name | 3,4-dibromo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrazole |
|---|---|
| PubChem CID | 171472470 |
| Molecular Formula | C10H16Br2N2O3 |
| Molecular Weight | 372.06 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 3,4-dibromo-1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrazole |
| SMILES | COCCOCCOCCn1cc(Br)c(Br)n1 |
| InChI | InChI=1S/C10H16Br2N2O3/c1-15-4-5-17-7-6-16-3-2-14-8-9(11)10(12)13-14/h8H,2-7H2,1H3 |
| InChIKey | GWGFUGWSMQFVSB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.06 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|