C13H14F2O — CID 171472859
4-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 171472859) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 4-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 171472859 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(difluoromethoxy)-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | FC(F)Oc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C13H14F2O/c14-13(15)16-12-10-5-1-3-8(10)7-9-4-2-6-11(9)12/h7,13H,1-6H2 |
| InChIKey | OHGSCSXZILOVIW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |