About 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine
4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine (PubChem CID 171473066) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine |
| PubChem CID | 171473066 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine |
| SMILES | CNCCCCC1CN(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C15H32N2/c1-14(2,3)17-12-13(11-15(17,4)5)9-7-8-10-16-6/h13,16H,7-12H2,1-6H3 |
| InChIKey | ABINMBKXLFONOA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine?
The IUPAC name of 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine (CID 171473066) is 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine.
What is the SMILES notation for 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine?
The canonical SMILES for 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine is CNCCCCC1CN(C(C)(C)C)C(C)(C)C1.
What is the InChIKey of 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine?
The InChIKey is ABINMBKXLFONOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2/c1-14(2,3)17-12-13(11-15(17,4)5)9-7-8-10-16-6/h13,16H,7-12H2,1-6H3.
What are the key properties of 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine?
4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine has a molecular weight of 240.43 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-tert-butyl-5,5-dimethylpyrrolidin-3-yl)-N-methylbutan-1-amine is sourced from PubChem (CID 171473066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).