C13H22N4O4 — CID 171473510
N-[(3R,4S)-3-methylheptan-4-yl]-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)acetamide (PubChem CID 171473510) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[(3R,4S)-3-methylheptan-4-yl]-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)acetamide.
| Compound Name | N-[(3R,4S)-3-methylheptan-4-yl]-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)acetamide |
|---|---|
| PubChem CID | 171473510 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-[(3R,4S)-3-methylheptan-4-yl]-2-(2,4,6-trioxo-1,3,5-triazinan-1-yl)acetamide |
| SMILES | CCC[C@H](NC(=O)Cn1c(=O)[nH]c(=O)[nH]c1=O)[C@H](C)CC |
| InChI | InChI=1S/C13H22N4O4/c1-4-6-9(8(3)5-2)14-10(18)7-17-12(20)15-11(19)16-13(17)21/h8-9H,4-7H2,1-3H3,(H,14,18)(H2,15,16,19,20,21)/t8-,9+/m1/s1 |
| InChIKey | VEJJJRMYPAKGCZ-BDAKNGLRSA-N |
| XLogP | -0.44 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |