C21H38N2O3 — CID 171473639
tert-butyl 9-[hydroxy(piperidin-4-yl)methyl]-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 171473639) has the molecular formula C21H38N2O3 and a molecular weight of 366.55 g/mol. Its IUPAC name is tert-butyl 9-[hydroxy(piperidin-4-yl)methyl]-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-[hydroxy(piperidin-4-yl)methyl]-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 171473639 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | tert-butyl 9-[hydroxy(piperidin-4-yl)methyl]-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C(O)C3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C21H38N2O3/c1-20(2,3)26-19(25)23-14-10-21(11-15-23)8-4-16(5-9-21)18(24)17-6-12-22-13-7-17/h16-18,22,24H,4-15H2,1-3H3 |
| InChIKey | WRINMGZUQZXAPA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |