C52H47F3N4O4S — CID 171474741
2-[3-[3-(3,5-ditert-butylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-[4-phenyl-5-(trideuteriomethyl)-2-pyridinyl]carbazole;trifluoromethanesulfonate (PubChem CID 171474741) has the molecular formula C52H47F3N4O4S and a molecular weight of 884.05 g/mol. Its IUPAC name is 2-[3-[3-(3,5-ditert-butylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-[4-phenyl-5-(trideuteriomethyl)-2-pyridinyl]carbazole;trifluoromethanesulfonate.
| Compound Name | 2-[3-[3-(3,5-ditert-butylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-[4-phenyl-5-(trideuteriomethyl)-2-pyridinyl]carbazole;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171474741 |
| Molecular Formula | C52H47F3N4O4S |
| Molecular Weight | 884.05 g/mol |
| Exact Mass | 883.35 |
| IUPAC Name | 2-[3-[3-(3,5-ditert-butylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9-[4-phenyl-5-(trideuteriomethyl)-2-pyridinyl]carbazole;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.[2H]C([2H])([2H])c1cnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5c[n+](-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccccc65)c4)cc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C51H47N4O.CHF3O3S/c1-34-32-52-49(31-44(34)35-16-9-8-10-17-35)55-45-21-12-11-20-42(45)43-25-24-41(30-48(43)55)56-40-19-15-18-38(29-40)53-33-54(47-23-14-13-22-46(47)53)39-27-36(50(2,3)4)26-37(28-39)51(5,6)7;2-1(3,4)8(5,6)7/h8-33H,1-7H3;(H,5,6,7)/q+1;/p-1/i1D3; |
| InChIKey | HTDXQWJEBILIRX-NIIDSAIPSA-M |
| XLogP | 12.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.05 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|