C45H50N4O9S — CID 171474924
4-[2-[2-[2-[2-[ethyl-[2-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 171474924) has the molecular formula C45H50N4O9S and a molecular weight of 822.98 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[ethyl-[2-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[2-[2-[ethyl-[2-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171474924 |
| Molecular Formula | C45H50N4O9S |
| Molecular Weight | 822.98 g/mol |
| Exact Mass | 822.33 |
| IUPAC Name | 4-[2-[2-[2-[2-[ethyl-[2-[4-[6-hydroxy-2-(4-methylsulfonylphenyl)naphthalen-1-yl]oxyphenoxy]ethyl]amino]ethoxy]ethoxy]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CCN(CCOCCOCCC1CNCCN1c1cccc2c1C(=O)NC2=O)CCOc1ccc(Oc2c(-c3ccc(S(C)(=O)=O)cc3)ccc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C45H50N4O9S/c1-3-48(22-25-56-28-27-55-24-19-33-30-46-20-21-49(33)41-6-4-5-40-42(41)45(52)47-44(40)51)23-26-57-35-11-13-36(14-12-35)58-43-38(17-9-32-29-34(50)10-18-39(32)43)31-7-15-37(16-8-31)59(2,53)54/h4-18,29,33,46,50H,3,19-28,30H2,1-2H3,(H,47,51,52) |
| InChIKey | FFMMZTBFCDBYKQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|