C21H27N5O — CID 171475107
(6R,11R)-6,11-dimethyl-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 171475107) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (6R,11R)-6,11-dimethyl-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (6R,11R)-6,11-dimethyl-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 171475107 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (6R,11R)-6,11-dimethyl-4-[1-(6-prop-1-en-2-yl-3-pyridinyl)ethyl]-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C=C(C)c1ccc(C(C)N2C[C@@H](C)n3nc4c(c3C2=O)CN[C@H](C)C4)cn1 |
| InChI | InChI=1S/C21H27N5O/c1-12(2)18-7-6-16(9-23-18)15(5)25-11-14(4)26-20(21(25)27)17-10-22-13(3)8-19(17)24-26/h6-7,9,13-15,22H,1,8,10-11H2,2-5H3/t13-,14-,15?/m1/s1 |
| InChIKey | WWFPAIZFTZYRMK-GRKKQISMSA-N |
| XLogP | 3.12 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |