C11H20FNO2 — CID 171475187
(2S)-2-[[(1S,4S)-3-fluoro-4-methylcyclohex-2-en-1-yl]amino]butane-1,2-diol (PubChem CID 171475187) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is (2S)-2-[[(1S,4S)-3-fluoro-4-methylcyclohex-2-en-1-yl]amino]butane-1,2-diol.
| Compound Name | (2S)-2-[[(1S,4S)-3-fluoro-4-methylcyclohex-2-en-1-yl]amino]butane-1,2-diol |
|---|---|
| PubChem CID | 171475187 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2S)-2-[[(1S,4S)-3-fluoro-4-methylcyclohex-2-en-1-yl]amino]butane-1,2-diol |
| SMILES | CC[C@](O)(CO)N[C@@H]1C=C(F)[C@@H](C)CC1 |
| InChI | InChI=1S/C11H20FNO2/c1-3-11(15,7-14)13-9-5-4-8(2)10(12)6-9/h6,8-9,13-15H,3-5,7H2,1-2H3/t8-,9-,11-/m0/s1 |
| InChIKey | MQIFPWSJIYGBES-QXEWZRGKSA-N |
| XLogP | 1.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|