C23H16Cl2N5O3+ — CID 171475792
3-[3-chloro-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 171475792) has the molecular formula C23H16Cl2N5O3+ and a molecular weight of 481.32 g/mol. Its IUPAC name is 3-[3-chloro-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 3-[3-chloro-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 171475792 |
| Molecular Formula | C23H16Cl2N5O3+ |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 3-[3-chloro-5-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-1-[(6-chloro-3-pyridinyl)methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | Cc1nc(-c2cc(Cl)cc(-c3c(O)[n+](Cc4ccc(Cl)nc4)c4ccccn4c3=O)c2)no1 |
| InChI | InChI=1S/C23H15Cl2N5O3/c1-13-27-21(28-33-13)16-8-15(9-17(24)10-16)20-22(31)29-7-3-2-4-19(29)30(23(20)32)12-14-5-6-18(25)26-11-14/h2-11H,12H2,1H3/p+1 |
| InChIKey | WFOYQYWOHQBHCO-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|