C29H28N4O2 — CID 171476870
2-[1-(2-ethoxyethyl)-5-quinolin-6-ylindol-3-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 171476870) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[1-(2-ethoxyethyl)-5-quinolin-6-ylindol-3-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[1-(2-ethoxyethyl)-5-quinolin-6-ylindol-3-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 171476870 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[1-(2-ethoxyethyl)-5-quinolin-6-ylindol-3-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CCOCCn1cc(CC(=O)NCc2ccccn2)c2cc(-c3ccc4ncccc4c3)ccc21 |
| InChI | InChI=1S/C29H28N4O2/c1-2-35-15-14-33-20-24(18-29(34)32-19-25-7-3-4-12-30-25)26-17-22(9-11-28(26)33)21-8-10-27-23(16-21)6-5-13-31-27/h3-13,16-17,20H,2,14-15,18-19H2,1H3,(H,32,34) |
| InChIKey | UQQYOLLQMYJSGC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|