About 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid
2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid (PubChem CID 171477073) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid |
| PubChem CID | 171477073 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid |
| SMILES | Cc1ccc(N2CC3(CCN(C)C3)C2)cc1C(=O)O |
| InChI | InChI=1S/C15H20N2O2/c1-11-3-4-12(7-13(11)14(18)19)17-9-15(10-17)5-6-16(2)8-15/h3-4,7H,5-6,8-10H2,1-2H3,(H,18,19) |
| InChIKey | IGZKUOSPMBCPCT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid?
The IUPAC name of 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid (CID 171477073) is 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid.
What is the SMILES notation for 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid?
The canonical SMILES for 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid is Cc1ccc(N2CC3(CCN(C)C3)C2)cc1C(=O)O.
What is the InChIKey of 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid?
The InChIKey is IGZKUOSPMBCPCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-11-3-4-12(7-13(11)14(18)19)17-9-15(10-17)5-6-16(2)8-15/h3-4,7H,5-6,8-10H2,1-2H3,(H,18,19).
What are the key properties of 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid?
2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid has a molecular weight of 260.34 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(7-methyl-2,7-diazaspiro[3.4]octan-2-yl)benzoic acid is sourced from PubChem (CID 171477073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).