About trihydroxy-(2,3,4-triethylphenoxy)silane
trihydroxy-(2,3,4-triethylphenoxy)silane (PubChem CID 171477195) has the molecular formula C12H20O4Si
and a molecular weight of 256.37 g/mol. Its IUPAC name is trihydroxy-(2,3,4-triethylphenoxy)silane.
Molecular Properties
| Compound Name | trihydroxy-(2,3,4-triethylphenoxy)silane |
| PubChem CID | 171477195 |
| Molecular Formula | C12H20O4Si |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | trihydroxy-(2,3,4-triethylphenoxy)silane |
| SMILES | CCc1ccc(O[Si](O)(O)O)c(CC)c1CC |
| InChI | InChI=1S/C12H20O4Si/c1-4-9-7-8-12(16-17(13,14)15)11(6-3)10(9)5-2/h7-8,13-15H,4-6H2,1-3H3 |
| InChIKey | UVVJNOFXPSDFBL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trihydroxy-(2,3,4-triethylphenoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxy-(2,3,4-triethylphenoxy)silane?
The IUPAC name of trihydroxy-(2,3,4-triethylphenoxy)silane (CID 171477195) is trihydroxy-(2,3,4-triethylphenoxy)silane.
What is the SMILES notation for trihydroxy-(2,3,4-triethylphenoxy)silane?
The canonical SMILES for trihydroxy-(2,3,4-triethylphenoxy)silane is CCc1ccc(O[Si](O)(O)O)c(CC)c1CC.
What is the InChIKey of trihydroxy-(2,3,4-triethylphenoxy)silane?
The InChIKey is UVVJNOFXPSDFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4Si/c1-4-9-7-8-12(16-17(13,14)15)11(6-3)10(9)5-2/h7-8,13-15H,4-6H2,1-3H3.
What are the key properties of trihydroxy-(2,3,4-triethylphenoxy)silane?
trihydroxy-(2,3,4-triethylphenoxy)silane has a molecular weight of 256.37 g/mol, XLogP of 1.17, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxy-(2,3,4-triethylphenoxy)silane is sourced from PubChem (CID 171477195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).