About 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one
9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one (PubChem CID 171477355) has the molecular formula C13H9BrO2
and a molecular weight of 277.12 g/mol. Its IUPAC name is 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one.
Molecular Properties
| Compound Name | 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| PubChem CID | 171477355 |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| SMILES | O=C1CCc2ccc3cc(O)cc(Br)c3c21 |
| InChI | InChI=1S/C13H9BrO2/c14-10-6-9(15)5-8-2-1-7-3-4-11(16)13(7)12(8)10/h1-2,5-6,15H,3-4H2 |
| InChIKey | YJVLSBOKVGOZLA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The IUPAC name of 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one (CID 171477355) is 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one.
What is the SMILES notation for 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The canonical SMILES for 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one is O=C1CCc2ccc3cc(O)cc(Br)c3c21.
What is the InChIKey of 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The InChIKey is YJVLSBOKVGOZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO2/c14-10-6-9(15)5-8-2-1-7-3-4-11(16)13(7)12(8)10/h1-2,5-6,15H,3-4H2.
What are the key properties of 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one?
9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one has a molecular weight of 277.12 g/mol, XLogP of 3.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-7-hydroxy-2,3-dihydrocyclopenta[a]naphthalen-1-one is sourced from PubChem (CID 171477355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).