About 1-deuteriophenoxathiine
1-deuteriophenoxathiine (PubChem CID 171478310) has the molecular formula C12H8OS
and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-deuteriophenoxathiine.
Molecular Properties
| Compound Name | 1-deuteriophenoxathiine |
| PubChem CID | 171478310 |
| Molecular Formula | C12H8OS |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 1-deuteriophenoxathiine |
| SMILES | [2H]c1cccc2c1Sc1ccccc1O2 |
| InChI | InChI=1S/C12H8OS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8H/i7D |
| InChIKey | GJSGGHOYGKMUPT-WHRKIXHSSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-deuteriophenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuteriophenoxathiine?
The IUPAC name of 1-deuteriophenoxathiine (CID 171478310) is 1-deuteriophenoxathiine.
What is the SMILES notation for 1-deuteriophenoxathiine?
The canonical SMILES for 1-deuteriophenoxathiine is [2H]c1cccc2c1Sc1ccccc1O2.
What is the InChIKey of 1-deuteriophenoxathiine?
The InChIKey is GJSGGHOYGKMUPT-WHRKIXHSSA-N. The full InChI is InChI=1S/C12H8OS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8H/i7D.
What are the key properties of 1-deuteriophenoxathiine?
1-deuteriophenoxathiine has a molecular weight of 201.27 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuteriophenoxathiine is sourced from PubChem (CID 171478310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).