C20H21N3O4S — CID 171478391
7-[(5Z)-2,4-dioxo-5-(quinolin-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-hydroxyheptanamide (PubChem CID 171478391) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 7-[(5Z)-2,4-dioxo-5-(quinolin-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[(5Z)-2,4-dioxo-5-(quinolin-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 171478391 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 7-[(5Z)-2,4-dioxo-5-(quinolin-3-ylmethylidene)-1,3-thiazolidin-3-yl]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCN1C(=O)S/C(=C\c2cnc3ccccc3c2)C1=O)NO |
| InChI | InChI=1S/C20H21N3O4S/c24-18(22-27)9-3-1-2-6-10-23-19(25)17(28-20(23)26)12-14-11-15-7-4-5-8-16(15)21-13-14/h4-5,7-8,11-13,27H,1-3,6,9-10H2,(H,22,24)/b17-12- |
| InChIKey | MRQDSLVMCOAATJ-ATVHPVEESA-N |
| XLogP | 3.73 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|