About (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid
(E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid (PubChem CID 171478481) has the molecular formula C11H13NO6
and a molecular weight of 255.23 g/mol. Its IUPAC name is (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid |
| PubChem CID | 171478481 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid |
| SMILES | COC(=O)/C(=C/C(=O)O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H13NO6/c1-18-11(17)7(6-10(15)16)4-5-12-8(13)2-3-9(12)14/h6H,2-5H2,1H3,(H,15,16)/b7-6+ |
| InChIKey | VCIGQNPTWUFNJG-VOTSOKGWSA-N |
| XLogP | -0.29 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid?
The IUPAC name of (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid (CID 171478481) is (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid.
What is the SMILES notation for (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid?
The canonical SMILES for (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid is COC(=O)/C(=C/C(=O)O)CCN1C(=O)CCC1=O.
What is the InChIKey of (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid?
The InChIKey is VCIGQNPTWUFNJG-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H13NO6/c1-18-11(17)7(6-10(15)16)4-5-12-8(13)2-3-9(12)14/h6H,2-5H2,1H3,(H,15,16)/b7-6+.
What are the key properties of (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid?
(E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid has a molecular weight of 255.23 g/mol, XLogP of -0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(2,5-dioxopyrrolidin-1-yl)-3-methoxycarbonylpent-2-enoic acid is sourced from PubChem (CID 171478481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).