About methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate
methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate (PubChem CID 171478933) has the molecular formula C8H12FNO2
and a molecular weight of 173.19 g/mol. Its IUPAC name is methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate |
| PubChem CID | 171478933 |
| Molecular Formula | C8H12FNO2 |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)[C@]1(C)CNCC=C1F |
| InChI | InChI=1S/C8H12FNO2/c1-8(7(11)12-2)5-10-4-3-6(8)9/h3,10H,4-5H2,1-2H3/t8-/m1/s1 |
| InChIKey | DUCRJJRWBJOMHJ-MRVPVSSYSA-N |
| XLogP | 0.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate?
The IUPAC name of methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate (CID 171478933) is methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate.
What is the SMILES notation for methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate?
The canonical SMILES for methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate is COC(=O)[C@]1(C)CNCC=C1F.
What is the InChIKey of methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate?
The InChIKey is DUCRJJRWBJOMHJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12FNO2/c1-8(7(11)12-2)5-10-4-3-6(8)9/h3,10H,4-5H2,1-2H3/t8-/m1/s1.
What are the key properties of methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate?
methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate has a molecular weight of 173.19 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-4-fluoro-3-methyl-2,6-dihydro-1H-pyridine-3-carboxylate is sourced from PubChem (CID 171478933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).