About [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol
[(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 171479044) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol |
| PubChem CID | 171479044 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CCN1CCC(F)(F)[C@](C)(CO)C1 |
| InChI | InChI=1S/C10H17F2NO/c1-3-5-13-6-4-10(11,12)9(2,7-13)8-14/h3,14H,1,4-8H2,2H3/t9-/m0/s1 |
| InChIKey | DOIPKYINSOQMSV-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol?
The IUPAC name of [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol (CID 171479044) is [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol?
The canonical SMILES for [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol is C=CCN1CCC(F)(F)[C@](C)(CO)C1.
What is the InChIKey of [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol?
The InChIKey is DOIPKYINSOQMSV-VIFPVBQESA-N. The full InChI is InChI=1S/C10H17F2NO/c1-3-5-13-6-4-10(11,12)9(2,7-13)8-14/h3,14H,1,4-8H2,2H3/t9-/m0/s1.
What are the key properties of [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol?
[(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol has a molecular weight of 205.25 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4,4-difluoro-3-methyl-1-prop-2-enylpiperidin-3-yl]methanol is sourced from PubChem (CID 171479044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).