C13H14F2N2O4 — CID 171479091
1,4-diacetyl-3-[(3,3-difluorocyclobutyl)methylidene]piperazine-2,5-dione (PubChem CID 171479091) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 1,4-diacetyl-3-[(3,3-difluorocyclobutyl)methylidene]piperazine-2,5-dione.
| Compound Name | 1,4-diacetyl-3-[(3,3-difluorocyclobutyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 171479091 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1,4-diacetyl-3-[(3,3-difluorocyclobutyl)methylidene]piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)N(C(C)=O)C(=CC2CC(F)(F)C2)C1=O |
| InChI | InChI=1S/C13H14F2N2O4/c1-7(18)16-6-11(20)17(8(2)19)10(12(16)21)3-9-4-13(14,15)5-9/h3,9H,4-6H2,1-2H3 |
| InChIKey | WWUQMBHOTAJLAX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|