C28H28N4O5 — CID 17147988
(7Z)-7-(dimethylaminomethylidene)-2-phenyl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-3H-pyrazolo[3,4-c]isoquinoline-1,6-dione (PubChem CID 17147988) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is (7Z)-7-(dimethylaminomethylidene)-2-phenyl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-3H-pyrazolo[3,4-c]isoquinoline-1,6-dione.
| Compound Name | (7Z)-7-(dimethylaminomethylidene)-2-phenyl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-3H-pyrazolo[3,4-c]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 17147988 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (7Z)-7-(dimethylaminomethylidene)-2-phenyl-8-(3,4,5-trimethoxyphenyl)-8,9-dihydro-3H-pyrazolo[3,4-c]isoquinoline-1,6-dione |
| SMILES | COc1cc(C2Cc3c(cnc4[nH]n(-c5ccccc5)c(=O)c34)C(=O)/C2=C\N(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C28H28N4O5/c1-31(2)15-21-18(16-11-22(35-3)26(37-5)23(12-16)36-4)13-19-20(25(21)33)14-29-27-24(19)28(34)32(30-27)17-9-7-6-8-10-17/h6-12,14-15,18H,13H2,1-5H3,(H,29,30)/b21-15- |
| InChIKey | NSLAIRMLGRGPFE-QNGOZBTKSA-N |
| XLogP | 3.71 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|