About 1,2-dimethylcyclopentane
1,2-dimethylcyclopentane (PubChem CID 17148) has the molecular formula C7H14
and a molecular weight of 98.19 g/mol. Its IUPAC name is 1,2-dimethylcyclopentane.
Molecular Properties
| Compound Name | 1,2-dimethylcyclopentane |
| PubChem CID | 17148 |
| Molecular Formula | C7H14 |
| Molecular Weight | 98.19 g/mol |
| Exact Mass | 98.11 |
| IUPAC Name | 1,2-dimethylcyclopentane |
| SMILES | CC1CCCC1C |
| InChI | InChI=1S/C7H14/c1-6-4-3-5-7(6)2/h6-7H,3-5H2,1-2H3 |
| InChIKey | RIRARCHMRDHZAR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylcyclopentane?
The IUPAC name of 1,2-dimethylcyclopentane (CID 17148) is 1,2-dimethylcyclopentane.
What is the SMILES notation for 1,2-dimethylcyclopentane?
The canonical SMILES for 1,2-dimethylcyclopentane is CC1CCCC1C.
What is the InChIKey of 1,2-dimethylcyclopentane?
The InChIKey is RIRARCHMRDHZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14/c1-6-4-3-5-7(6)2/h6-7H,3-5H2,1-2H3.
What are the key properties of 1,2-dimethylcyclopentane?
1,2-dimethylcyclopentane has a molecular weight of 98.19 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylcyclopentane is sourced from PubChem (CID 17148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).