C19H21N3O4 — CID 17148094
1-butyl-5-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 17148094) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-butyl-5-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17148094 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-butyl-5-(3,4-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c(-c3ccc(OC)c(OC)c3)ccnc21 |
| InChI | InChI=1S/C19H21N3O4/c1-4-5-10-22-17-16(18(23)21-19(22)24)13(8-9-20-17)12-6-7-14(25-2)15(11-12)26-3/h6-9,11H,4-5,10H2,1-3H3,(H,21,23,24) |
| InChIKey | AANSZMBDGJOAIR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |