C29H28ClN7O2S — CID 171481798
(E)-N-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 171481798) has the molecular formula C29H28ClN7O2S and a molecular weight of 574.11 g/mol. Its IUPAC name is (E)-N-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 171481798 |
| Molecular Formula | C29H28ClN7O2S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | (E)-N-[2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]ethyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCNC(=O)/C=C/c1cccnc1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H28ClN7O2S/c1-17-18(2)40-29-26(17)27(21-7-9-22(30)10-8-21)34-23(28-36-35-19(3)37(28)29)15-25(39)33-14-13-32-24(38)11-6-20-5-4-12-31-16-20/h4-12,16,23H,13-15H2,1-3H3,(H,32,38)(H,33,39)/b11-6+/t23-/m0/s1 |
| InChIKey | BIUDFTNJMGSWCJ-VMMLISQSSA-N |
| XLogP | 4.53 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|