C33H28ClN7O2S — CID 171481800
(E)-N-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 171481800) has the molecular formula C33H28ClN7O2S and a molecular weight of 622.15 g/mol. Its IUPAC name is (E)-N-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 171481800 |
| Molecular Formula | C33H28ClN7O2S |
| Molecular Weight | 622.15 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | (E)-N-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1ccc(NC(=O)/C=C/c3cccnc3)cc1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C33H28ClN7O2S/c1-19-20(2)44-33-30(19)31(23-7-9-24(34)10-8-23)38-27(32-40-39-21(3)41(32)33)17-29(43)37-26-13-11-25(12-14-26)36-28(42)15-6-22-5-4-16-35-18-22/h4-16,18,27H,17H2,1-3H3,(H,36,42)(H,37,43)/b15-6+/t27-/m0/s1 |
| InChIKey | LWWOQEWLNDWJLG-ODVZWJMOSA-N |
| XLogP | 6.88 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.15 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|