C19H28O10 — CID 171482306
methyl 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-pent-4-enoxyoxan-2-yl]acetate (PubChem CID 171482306) has the molecular formula C19H28O10 and a molecular weight of 416.42 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-pent-4-enoxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-pent-4-enoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 171482306 |
| Molecular Formula | C19H28O10 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-pent-4-enoxyoxan-2-yl]acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](CC(=O)OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H28O10/c1-6-7-8-9-25-19-18(28-13(4)22)17(27-12(3)21)16(26-11(2)20)14(29-19)10-15(23)24-5/h6,14,16-19H,1,7-10H2,2-5H3/t14-,16-,17+,18-,19-/m1/s1 |
| InChIKey | SVCXNRSYVOXLHP-IQZDNPOKSA-N |
| XLogP | 1.05 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|