About 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile
6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile (PubChem CID 171482377) has the molecular formula C11H5Cl2N3
and a molecular weight of 250.09 g/mol. Its IUPAC name is 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile |
| PubChem CID | 171482377 |
| Molecular Formula | C11H5Cl2N3 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(-c2cnc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H5Cl2N3/c12-9-4-11(13)15-6-8(9)10-3-1-2-7(5-14)16-10/h1-4,6H |
| InChIKey | QSVTZYOLCKEXGI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile?
The IUPAC name of 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile (CID 171482377) is 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile.
What is the SMILES notation for 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile?
The canonical SMILES for 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile is N#Cc1cccc(-c2cnc(Cl)cc2Cl)n1.
What is the InChIKey of 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile?
The InChIKey is QSVTZYOLCKEXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2N3/c12-9-4-11(13)15-6-8(9)10-3-1-2-7(5-14)16-10/h1-4,6H.
What are the key properties of 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile?
6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile has a molecular weight of 250.09 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,6-dichloro-3-pyridinyl)pyridine-2-carbonitrile is sourced from PubChem (CID 171482377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).