C21H16FNO3 — CID 171482637
ethyl (2R)-2-(4-fluorophenyl)-3-oxo-1H-benzo[g]indole-2-carboxylate (PubChem CID 171482637) has the molecular formula C21H16FNO3 and a molecular weight of 349.36 g/mol. Its IUPAC name is ethyl (2R)-2-(4-fluorophenyl)-3-oxo-1H-benzo[g]indole-2-carboxylate.
| Compound Name | ethyl (2R)-2-(4-fluorophenyl)-3-oxo-1H-benzo[g]indole-2-carboxylate |
|---|---|
| PubChem CID | 171482637 |
| Molecular Formula | C21H16FNO3 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl (2R)-2-(4-fluorophenyl)-3-oxo-1H-benzo[g]indole-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccc(F)cc2)Nc2c(ccc3ccccc23)C1=O |
| InChI | InChI=1S/C21H16FNO3/c1-2-26-20(25)21(14-8-10-15(22)11-9-14)19(24)17-12-7-13-5-3-4-6-16(13)18(17)23-21/h3-12,23H,2H2,1H3/t21-/m1/s1 |
| InChIKey | PDTSNNIMPOYWJI-OAQYLSRUSA-N |
| XLogP | 4.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|