About 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone
1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 171483119) has the molecular formula C20H17ClN2O2S
and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone |
| PubChem CID | 171483119 |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | O=C(Cc1csc(COc2ccccc2)n1)N1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C20H17ClN2O2S/c21-17-7-4-8-18-16(17)9-10-23(18)20(24)11-14-13-26-19(22-14)12-25-15-5-2-1-3-6-15/h1-8,13H,9-12H2 |
| InChIKey | VEGHRSBOLIXWTQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone (CID 171483119) is 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone is O=C(Cc1csc(COc2ccccc2)n1)N1CCc2c(Cl)cccc21.
What is the InChIKey of 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone?
The InChIKey is VEGHRSBOLIXWTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O2S/c21-17-7-4-8-18-16(17)9-10-23(18)20(24)11-14-13-26-19(22-14)12-25-15-5-2-1-3-6-15/h1-8,13H,9-12H2.
What are the key properties of 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone?
1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone has a molecular weight of 384.89 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2,3-dihydroindol-1-yl)-2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 171483119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).