About 3-fluoro-1,6-dihydropyrimidin-2-one
3-fluoro-1,6-dihydropyrimidin-2-one (PubChem CID 171483163) has the molecular formula C4H5FN2O
and a molecular weight of 116.09 g/mol. Its IUPAC name is 3-fluoro-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3-fluoro-1,6-dihydropyrimidin-2-one |
| PubChem CID | 171483163 |
| Molecular Formula | C4H5FN2O |
| Molecular Weight | 116.09 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 3-fluoro-1,6-dihydropyrimidin-2-one |
| SMILES | O=C1NCC=CN1F |
| InChI | InChI=1S/C4H5FN2O/c5-7-3-1-2-6-4(7)8/h1,3H,2H2,(H,6,8) |
| InChIKey | XPZOXACQKZDGMG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.09 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,6-dihydropyrimidin-2-one?
The IUPAC name of 3-fluoro-1,6-dihydropyrimidin-2-one (CID 171483163) is 3-fluoro-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 3-fluoro-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 3-fluoro-1,6-dihydropyrimidin-2-one is O=C1NCC=CN1F.
What is the InChIKey of 3-fluoro-1,6-dihydropyrimidin-2-one?
The InChIKey is XPZOXACQKZDGMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FN2O/c5-7-3-1-2-6-4(7)8/h1,3H,2H2,(H,6,8).
What are the key properties of 3-fluoro-1,6-dihydropyrimidin-2-one?
3-fluoro-1,6-dihydropyrimidin-2-one has a molecular weight of 116.09 g/mol, XLogP of 0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 171483163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).