About 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene
1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene (PubChem CID 171483612) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene |
| PubChem CID | 171483612 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene |
| SMILES | CCOC(/C=C/C1=CCC(C)(C)CC1)OCC |
| InChI | InChI=1S/C15H26O2/c1-5-16-14(17-6-2)8-7-13-9-11-15(3,4)12-10-13/h7-9,14H,5-6,10-12H2,1-4H3/b8-7+ |
| InChIKey | DQYNNCDXPDGZPN-BQYQJAHWSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene?
The IUPAC name of 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene (CID 171483612) is 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene.
What is the SMILES notation for 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene?
The canonical SMILES for 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene is CCOC(/C=C/C1=CCC(C)(C)CC1)OCC.
What is the InChIKey of 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene?
The InChIKey is DQYNNCDXPDGZPN-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H26O2/c1-5-16-14(17-6-2)8-7-13-9-11-15(3,4)12-10-13/h7-9,14H,5-6,10-12H2,1-4H3/b8-7+.
What are the key properties of 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene?
1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene has a molecular weight of 238.37 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3-diethoxyprop-1-enyl]-4,4-dimethylcyclohexene is sourced from PubChem (CID 171483612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).