About 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol
1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol (PubChem CID 171483666) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol |
| PubChem CID | 171483666 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol |
| SMILES | CCOC(/C=C/C1(O)CCCCC1)OCC |
| InChI | InChI=1S/C13H24O3/c1-3-15-12(16-4-2)8-11-13(14)9-6-5-7-10-13/h8,11-12,14H,3-7,9-10H2,1-2H3/b11-8+ |
| InChIKey | RVSRXAYXFJNMQE-DHZHZOJOSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol?
The IUPAC name of 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol (CID 171483666) is 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol is CCOC(/C=C/C1(O)CCCCC1)OCC.
What is the InChIKey of 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol?
The InChIKey is RVSRXAYXFJNMQE-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H24O3/c1-3-15-12(16-4-2)8-11-13(14)9-6-5-7-10-13/h8,11-12,14H,3-7,9-10H2,1-2H3/b11-8+.
What are the key properties of 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol?
1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol has a molecular weight of 228.33 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3-diethoxyprop-1-enyl]cyclohexan-1-ol is sourced from PubChem (CID 171483666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).