About 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide
3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide (PubChem CID 171484175) has the molecular formula C12H14BrF2NO3
and a molecular weight of 338.15 g/mol. Its IUPAC name is 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide.
Molecular Properties
| Compound Name | 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide |
| PubChem CID | 171484175 |
| Molecular Formula | C12H14BrF2NO3 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide |
| SMILES | COCC(F)(F)c1ccc(C(=O)N(C)OC)cc1Br |
| InChI | InChI=1S/C12H14BrF2NO3/c1-16(19-3)11(17)8-4-5-9(10(13)6-8)12(14,15)7-18-2/h4-6H,7H2,1-3H3 |
| InChIKey | UGVGIWCHQAQHRV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide?
The IUPAC name of 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide (CID 171484175) is 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide.
What is the SMILES notation for 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide?
The canonical SMILES for 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide is COCC(F)(F)c1ccc(C(=O)N(C)OC)cc1Br.
What is the InChIKey of 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide?
The InChIKey is UGVGIWCHQAQHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrF2NO3/c1-16(19-3)11(17)8-4-5-9(10(13)6-8)12(14,15)7-18-2/h4-6H,7H2,1-3H3.
What are the key properties of 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide?
3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide has a molecular weight of 338.15 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(1,1-difluoro-2-methoxyethyl)-N-methoxy-N-methylbenzamide is sourced from PubChem (CID 171484175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).