About 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one
5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one (PubChem CID 171484656) has the molecular formula C10H12BrF2N3O
and a molecular weight of 308.13 g/mol. Its IUPAC name is 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one |
| PubChem CID | 171484656 |
| Molecular Formula | C10H12BrF2N3O |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one |
| SMILES | Cn1cc(Br)nc(N2CCC(F)(F)CC2)c1=O |
| InChI | InChI=1S/C10H12BrF2N3O/c1-15-6-7(11)14-8(9(15)17)16-4-2-10(12,13)3-5-16/h6H,2-5H2,1H3 |
| InChIKey | XKABNJOJUXIWMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one?
The IUPAC name of 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one (CID 171484656) is 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one.
What is the SMILES notation for 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one?
The canonical SMILES for 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one is Cn1cc(Br)nc(N2CCC(F)(F)CC2)c1=O.
What is the InChIKey of 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one?
The InChIKey is XKABNJOJUXIWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrF2N3O/c1-15-6-7(11)14-8(9(15)17)16-4-2-10(12,13)3-5-16/h6H,2-5H2,1H3.
What are the key properties of 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one?
5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one has a molecular weight of 308.13 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(4,4-difluoropiperidin-1-yl)-1-methylpyrazin-2-one is sourced from PubChem (CID 171484656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).